C29H52O7Si — CID 23248537
(4S,5R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3-methylhex-2-enyl]-4-[2-(1,3-dioxolan-2-yl)ethyl]-3-(hydroxymethyl)-4,5-dimethylcyclohex-2-en-1-one (PubChem CID 23248537) has the molecular formula C29H52O7Si and a molecular weight of 540.81 g/mol. Its IUPAC name is (4S,5R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3-methylhex-2-enyl]-4-[2-(1,3-dioxolan-2-yl)ethyl]-3-(hydroxymethyl)-4,5-dimethylcyclohex-2-en-1-one.
| Compound Name | (4S,5R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3-methylhex-2-enyl]-4-[2-(1,3-dioxolan-2-yl)ethyl]-3-(hydroxymethyl)-4,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 23248537 |
| Molecular Formula | C29H52O7Si |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | (4S,5R)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-3-methylhex-2-enyl]-4-[2-(1,3-dioxolan-2-yl)ethyl]-3-(hydroxymethyl)-4,5-dimethylcyclohex-2-en-1-one |
| SMILES | COCOC(/C=C(\C)CCCO[Si](C)(C)C(C)(C)C)C1=C(CO)[C@@](C)(CCC2OCCO2)[C@H](C)CC1=O |
| InChI | InChI=1S/C29H52O7Si/c1-21(11-10-14-36-37(8,9)28(3,4)5)17-25(35-20-32-7)27-23(19-30)29(6,22(2)18-24(27)31)13-12-26-33-15-16-34-26/h17,22,25-26,30H,10-16,18-20H2,1-9H3/b21-17+/t22-,25?,29+/m1/s1 |
| InChIKey | FJTCTIBVMNKLQF-AHLCEVTKSA-N |
| XLogP | 5.78 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|