C24H42O4Si — CID 11729527
(1R,2S,3E,7E,11S,13S)-2-[tert-butyl(dimethyl)silyl]oxy-13-methoxy-4,8,14,14-tetramethyl-12-oxabicyclo[9.2.1]tetradeca-3,7-dien-9-one (PubChem CID 11729527) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is (1R,2S,3E,7E,11S,13S)-2-[tert-butyl(dimethyl)silyl]oxy-13-methoxy-4,8,14,14-tetramethyl-12-oxabicyclo[9.2.1]tetradeca-3,7-dien-9-one.
| Compound Name | (1R,2S,3E,7E,11S,13S)-2-[tert-butyl(dimethyl)silyl]oxy-13-methoxy-4,8,14,14-tetramethyl-12-oxabicyclo[9.2.1]tetradeca-3,7-dien-9-one |
|---|---|
| PubChem CID | 11729527 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (1R,2S,3E,7E,11S,13S)-2-[tert-butyl(dimethyl)silyl]oxy-13-methoxy-4,8,14,14-tetramethyl-12-oxabicyclo[9.2.1]tetradeca-3,7-dien-9-one |
| SMILES | CO[C@H]1O[C@H]2CC(=O)/C(C)=C/CC/C(C)=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C2(C)C |
| InChI | InChI=1S/C24H42O4Si/c1-16-12-11-13-17(2)18(25)15-20-24(6,7)21(22(26-8)27-20)19(14-16)28-29(9,10)23(3,4)5/h13-14,19-22H,11-12,15H2,1-10H3/b16-14+,17-13+/t19-,20-,21+,22-/m0/s1 |
| InChIKey | HHCUSYOVJYKWDN-NQMVDYHCSA-N |
| XLogP | 6.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|