C26H42O4Si — CID 10388893
(1'R,3'aS,9'S,10'bS)-9'-[tert-butyl(dimethyl)silyl]oxy-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,9,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one (PubChem CID 10388893) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is (1'R,3'aS,9'S,10'bS)-9'-[tert-butyl(dimethyl)silyl]oxy-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,9,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one.
| Compound Name | (1'R,3'aS,9'S,10'bS)-9'-[tert-butyl(dimethyl)silyl]oxy-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,9,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one |
|---|---|
| PubChem CID | 10388893 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (1'R,3'aS,9'S,10'bS)-9'-[tert-butyl(dimethyl)silyl]oxy-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,9,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one |
| SMILES | CC(C)[C@H]1CC[C@]2(C)C(=O)C=C3C(=C[C@@H](O[Si](C)(C)C(C)(C)C)CCC34OCCO4)[C@H]12 |
| InChI | InChI=1S/C26H42O4Si/c1-17(2)19-10-11-25(6)22(27)16-21-20(23(19)25)15-18(30-31(7,8)24(3,4)5)9-12-26(21)28-13-14-29-26/h15-19,23H,9-14H2,1-8H3/t18-,19+,23-,25+/m0/s1 |
| InChIKey | AKYLIGQQDIKEGZ-DDOGDFNNSA-N |
| XLogP | 6.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|