C20H28O3 — CID 10358408
(1'R,3'aS,10'aR,10'bS)-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,10a,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one (PubChem CID 10358408) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1'R,3'aS,10'aR,10'bS)-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,10a,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one.
| Compound Name | (1'R,3'aS,10'aR,10'bS)-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,10a,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one |
|---|---|
| PubChem CID | 10358408 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1'R,3'aS,10'aR,10'bS)-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,10a,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one |
| SMILES | CC(C)[C@H]1CC[C@]2(C)C(=O)C=C3[C@H](C=CCCC34OCCO4)[C@H]12 |
| InChI | InChI=1S/C20H28O3/c1-13(2)14-7-9-19(3)17(21)12-16-15(18(14)19)6-4-5-8-20(16)22-10-11-23-20/h4,6,12-15,18H,5,7-11H2,1-3H3/t14-,15+,18+,19-/m1/s1 |
| InChIKey | QEKQRSAHYPLFIP-LVFSCSRESA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|