C16H24O3 — CID 135020109
(3'aR,4'R,7'aS)-3',3',3'a,4',7'a-pentamethylspiro[1,3-dioxolane-2,2'-1,4-dihydroindene]-5'-one (PubChem CID 135020109) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (3'aR,4'R,7'aS)-3',3',3'a,4',7'a-pentamethylspiro[1,3-dioxolane-2,2'-1,4-dihydroindene]-5'-one.
| Compound Name | (3'aR,4'R,7'aS)-3',3',3'a,4',7'a-pentamethylspiro[1,3-dioxolane-2,2'-1,4-dihydroindene]-5'-one |
|---|---|
| PubChem CID | 135020109 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3'aR,4'R,7'aS)-3',3',3'a,4',7'a-pentamethylspiro[1,3-dioxolane-2,2'-1,4-dihydroindene]-5'-one |
| SMILES | C[C@H]1C(=O)C=C[C@]2(C)CC3(OCCO3)C(C)(C)[C@]12C |
| InChI | InChI=1S/C16H24O3/c1-11-12(17)6-7-14(4)10-16(18-8-9-19-16)13(2,3)15(11,14)5/h6-7,11H,8-10H2,1-5H3/t11-,14+,15-/m0/s1 |
| InChIKey | ZHVSRXNOPRTGAH-GLQYFDAESA-N |
| XLogP | 2.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |