C21H32O3 — CID 53348457
(3'R,3'aR,5'aS,10'aS)-3'a,5'a-dimethyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7,8,10a-octahydrobenzo[f]azulene]-10'-one (PubChem CID 53348457) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (3'R,3'aR,5'aS,10'aS)-3'a,5'a-dimethyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7,8,10a-octahydrobenzo[f]azulene]-10'-one.
| Compound Name | (3'R,3'aR,5'aS,10'aS)-3'a,5'a-dimethyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7,8,10a-octahydrobenzo[f]azulene]-10'-one |
|---|---|
| PubChem CID | 53348457 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (3'R,3'aR,5'aS,10'aS)-3'a,5'a-dimethyl-3'-propan-2-ylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7,8,10a-octahydrobenzo[f]azulene]-10'-one |
| SMILES | CC(C)[C@H]1CC2(OCCO2)[C@@H]2C(=O)C3=CCCC[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C21H32O3/c1-14(2)16-13-21(23-11-12-24-21)18-17(22)15-7-5-6-8-19(15,3)9-10-20(16,18)4/h7,14,16,18H,5-6,8-13H2,1-4H3/t16-,18-,19+,20-/m1/s1 |
| InChIKey | YNKPWOCSKRCFGG-RSPOEFSDSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |