C16H22O3 — CID 11207737
(1'S,2'S,7'R)-2',6',6'-trimethylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.1.01,5]undec-4-ene]-3'-one (PubChem CID 11207737) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1'S,2'S,7'R)-2',6',6'-trimethylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.1.01,5]undec-4-ene]-3'-one.
| Compound Name | (1'S,2'S,7'R)-2',6',6'-trimethylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.1.01,5]undec-4-ene]-3'-one |
|---|---|
| PubChem CID | 11207737 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1'S,2'S,7'R)-2',6',6'-trimethylspiro[1,3-dioxolane-2,8'-tricyclo[5.3.1.01,5]undec-4-ene]-3'-one |
| SMILES | C[C@@H]1C(=O)C=C2C(C)(C)[C@H]3C[C@]21CCC31OCCO1 |
| InChI | InChI=1S/C16H22O3/c1-10-11(17)8-12-14(2,3)13-9-15(10,12)4-5-16(13)18-6-7-19-16/h8,10,13H,4-7,9H2,1-3H3/t10-,13-,15+/m1/s1 |
| InChIKey | JVVCGPOEJDFYLM-YVLXSGLVSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |