C18H26O3 — CID 67897546
(2R,3aR)-2,3a,6-trimethylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-3-one (PubChem CID 67897546) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (2R,3aR)-2,3a,6-trimethylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-3-one.
| Compound Name | (2R,3aR)-2,3a,6-trimethylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-3-one |
|---|---|
| PubChem CID | 67897546 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2R,3aR)-2,3a,6-trimethylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-3-one |
| SMILES | CC1C2=CC[C@@]3(C)C(=O)[C@H](C)CC3C2CCC12OCCO2 |
| InChI | InChI=1S/C18H26O3/c1-11-10-15-14-5-7-18(20-8-9-21-18)12(2)13(14)4-6-17(15,3)16(11)19/h4,11-12,14-15H,5-10H2,1-3H3/t11-,12?,14?,15?,17-/m1/s1 |
| InChIKey | PMSBGIQZHYGRBN-HTBLCRBISA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|