C18H26O3 — CID 154720141
(2aS,6S,7aS,7bS)-5,5,7b-trimethyl-6-(2-methyl-1,3-dioxolan-2-yl)-1,2,2a,6,7,7a-hexahydrocyclobuta[e]inden-3-one (PubChem CID 154720141) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (2aS,6S,7aS,7bS)-5,5,7b-trimethyl-6-(2-methyl-1,3-dioxolan-2-yl)-1,2,2a,6,7,7a-hexahydrocyclobuta[e]inden-3-one.
| Compound Name | (2aS,6S,7aS,7bS)-5,5,7b-trimethyl-6-(2-methyl-1,3-dioxolan-2-yl)-1,2,2a,6,7,7a-hexahydrocyclobuta[e]inden-3-one |
|---|---|
| PubChem CID | 154720141 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2aS,6S,7aS,7bS)-5,5,7b-trimethyl-6-(2-methyl-1,3-dioxolan-2-yl)-1,2,2a,6,7,7a-hexahydrocyclobuta[e]inden-3-one |
| SMILES | CC1([C@H]2C[C@@H]3C(=CC(=O)[C@H]4CC[C@]43C)C2(C)C)OCCO1 |
| InChI | InChI=1S/C18H26O3/c1-16(2)12-9-14(19)11-5-6-17(11,3)13(12)10-15(16)18(4)20-7-8-21-18/h9,11,13,15H,5-8,10H2,1-4H3/t11-,13-,15+,17-/m1/s1 |
| InChIKey | NDZKXAZARYUTDL-JSHWQEIDSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |