C14H20O3 — CID 135040796
(3'aS,7'aR)-3',3',7'a-trimethylspiro[1,3-dioxolane-2,2'-3a,4-dihydro-1H-indene]-5'-one (PubChem CID 135040796) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3'aS,7'aR)-3',3',7'a-trimethylspiro[1,3-dioxolane-2,2'-3a,4-dihydro-1H-indene]-5'-one.
| Compound Name | (3'aS,7'aR)-3',3',7'a-trimethylspiro[1,3-dioxolane-2,2'-3a,4-dihydro-1H-indene]-5'-one |
|---|---|
| PubChem CID | 135040796 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3'aS,7'aR)-3',3',7'a-trimethylspiro[1,3-dioxolane-2,2'-3a,4-dihydro-1H-indene]-5'-one |
| SMILES | CC1(C)[C@H]2CC(=O)C=C[C@@]2(C)CC12OCCO2 |
| InChI | InChI=1S/C14H20O3/c1-12(2)11-8-10(15)4-5-13(11,3)9-14(12)16-6-7-17-14/h4-5,11H,6-9H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | MEZDOOPGTASHHX-YPMHNXCESA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |