C20H30O3 — CID 51003024
(1R,3aS,9bR)-3a,8-dimethyl-1-propan-2-ylspiro[1,2,3,4,5a,9,9a,9b-octahydrocyclopenta[a]naphthalene-6,2'-1,3-dioxolane]-5-one (PubChem CID 51003024) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,3aS,9bR)-3a,8-dimethyl-1-propan-2-ylspiro[1,2,3,4,5a,9,9a,9b-octahydrocyclopenta[a]naphthalene-6,2'-1,3-dioxolane]-5-one.
| Compound Name | (1R,3aS,9bR)-3a,8-dimethyl-1-propan-2-ylspiro[1,2,3,4,5a,9,9a,9b-octahydrocyclopenta[a]naphthalene-6,2'-1,3-dioxolane]-5-one |
|---|---|
| PubChem CID | 51003024 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,3aS,9bR)-3a,8-dimethyl-1-propan-2-ylspiro[1,2,3,4,5a,9,9a,9b-octahydrocyclopenta[a]naphthalene-6,2'-1,3-dioxolane]-5-one |
| SMILES | CC1=CC2(OCCO2)C2C(=O)C[C@]3(C)CC[C@H](C(C)C)[C@@H]3C2C1 |
| InChI | InChI=1S/C20H30O3/c1-12(2)14-5-6-19(4)11-16(21)18-15(17(14)19)9-13(3)10-20(18)22-7-8-23-20/h10,12,14-15,17-18H,5-9,11H2,1-4H3/t14-,15?,17-,18?,19+/m1/s1 |
| InChIKey | YMDRUBPYNMVOKJ-FQEDSBPFSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|