C17H29NO — CID 112510879
2-(3-methylbutylamino)-1-(2,3,5,6-tetramethylphenyl)ethanol (PubChem CID 112510879) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-1-(2,3,5,6-tetramethylphenyl)ethanol.
| Compound Name | 2-(3-methylbutylamino)-1-(2,3,5,6-tetramethylphenyl)ethanol |
|---|---|
| PubChem CID | 112510879 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-(3-methylbutylamino)-1-(2,3,5,6-tetramethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(C)c(C(O)CNCCC(C)C)c1C |
| InChI | InChI=1S/C17H29NO/c1-11(2)7-8-18-10-16(19)17-14(5)12(3)9-13(4)15(17)6/h9,11,16,18-19H,7-8,10H2,1-6H3 |
| InChIKey | AOAOTQJBACRCQD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|