C36H53NO6SSn — CID 11251223
tert-butyl (1R,2S,6R,7S)-8-(benzenesulfonyl)-4-phenyl-9-tributylstannyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]decane-10-carboxylate (PubChem CID 11251223) has the molecular formula C36H53NO6SSn and a molecular weight of 746.60 g/mol. Its IUPAC name is tert-butyl (1R,2S,6R,7S)-8-(benzenesulfonyl)-4-phenyl-9-tributylstannyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]decane-10-carboxylate.
| Compound Name | tert-butyl (1R,2S,6R,7S)-8-(benzenesulfonyl)-4-phenyl-9-tributylstannyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]decane-10-carboxylate |
|---|---|
| PubChem CID | 11251223 |
| Molecular Formula | C36H53NO6SSn |
| Molecular Weight | 746.60 g/mol |
| Exact Mass | 747.26 |
| IUPAC Name | tert-butyl (1R,2S,6R,7S)-8-(benzenesulfonyl)-4-phenyl-9-tributylstannyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]decane-10-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1C(S(=O)(=O)c2ccccc2)[C@@H]2[C@H]3OC(c4ccccc4)O[C@H]3[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H26NO6S.3C4H9.Sn/c1-24(2,3)31-23(26)25-17-14-18(32(27,28)16-12-8-5-9-13-16)19(25)21-20(17)29-22(30-21)15-10-6-4-7-11-15;3*1-3-4-2;/h4-14,17-22H,1-3H3;3*1,3-4H2,2H3;/t17-,18?,19+,20-,21+,22?;;;;/m0..../s1 |
| InChIKey | WBZUOLCOAOGRQV-LTAAFSBTSA-N |
| XLogP | 8.53 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.60 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |