C12H13N3O2 — CID 112513822
N-benzyl-N-methyl-5-oxo-1,2-dihydropyrazole-3-carboxamide (PubChem CID 112513822) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is N-benzyl-N-methyl-5-oxo-1,2-dihydropyrazole-3-carboxamide.
| Compound Name | N-benzyl-N-methyl-5-oxo-1,2-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112513822 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-benzyl-N-methyl-5-oxo-1,2-dihydropyrazole-3-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C12H13N3O2/c1-15(8-9-5-3-2-4-6-9)12(17)10-7-11(16)14-13-10/h2-7H,8H2,1H3,(H2,13,14,16) |
| InChIKey | KACHAVKRCPBSMD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |