About bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin
bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin (PubChem CID 11251476) has the molecular formula C44H34Cl2F2O4Sn
and a molecular weight of 854.37 g/mol. Its IUPAC name is bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin.
Molecular Properties
| Compound Name | bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin |
| PubChem CID | 11251476 |
| Molecular Formula | C44H34Cl2F2O4Sn |
| Molecular Weight | 854.37 g/mol |
| Exact Mass | 854.08 |
| IUPAC Name | bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin |
| SMILES | O=C(O)/C(=C/c1cccc(F)c1)c1ccc(Cl)cc1.O=C(O)/C(=C/c1cccc(F)c1)c1ccc(Cl)cc1.c1ccc(C[Sn]Cc2ccccc2)cc1 |
| InChI | InChI=1S/2C15H10ClFO2.2C7H7.Sn/c2*16-12-6-4-11(5-7-12)14(15(18)19)9-10-2-1-3-13(17)8-10;2*1-7-5-3-2-4-6-7;/h2*1-9H,(H,18,19);2*2-6H,1H2;/b2*14-9+;;; |
| InChIKey | IUPJUBAQDQEYCX-MNDNPDPASA-N |
| XLogP | 11.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 854.37 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin?
The IUPAC name of bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin (CID 11251476) is bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin.
What is the SMILES notation for bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin?
The canonical SMILES for bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin is O=C(O)/C(=C/c1cccc(F)c1)c1ccc(Cl)cc1.O=C(O)/C(=C/c1cccc(F)c1)c1ccc(Cl)cc1.c1ccc(C[Sn]Cc2ccccc2)cc1.
What is the InChIKey of bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin?
The InChIKey is IUPJUBAQDQEYCX-MNDNPDPASA-N. The full InChI is InChI=1S/2C15H10ClFO2.2C7H7.Sn/c2*16-12-6-4-11(5-7-12)14(15(18)19)9-10-2-1-3-13(17)8-10;2*1-7-5-3-2-4-6-7;/h2*1-9H,(H,18,19);2*2-6H,1H2;/b2*14-9+;;;.
What are the key properties of bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin?
bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin has a molecular weight of 854.37 g/mol, XLogP of 11.30, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-2-(4-chlorophenyl)-3-(3-fluorophenyl)prop-2-enoic acid);dibenzyltin is sourced from PubChem (CID 11251476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).