2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid

C15H22O4 — CID 112514986

IUPAC2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid
SMILESCOc1c(C)cc(C)cc1C(OCC(=O)O)C(C)C
InChIInChI=1S/C15H22O4/c1-9(2)14(19-8-13(16)17)12-7-10(3)6-11(4)15(12)18-5/h6-7,9,14H,8H2,1-5H3,(H,16,17)
InChIKeyTXOANXFPVGXMIQ-UHFFFAOYSA-N
MW266.34 g/mol
LogP3.11
Rot. Bonds6

About 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid

2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid (PubChem CID 112514986) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid.

Molecular Properties

Compound Name2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid
PubChem CID112514986
Molecular FormulaC15H22O4
Molecular Weight266.34 g/mol
Exact Mass266.15
IUPAC Name2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid
SMILESCOc1c(C)cc(C)cc1C(OCC(=O)O)C(C)C
InChIInChI=1S/C15H22O4/c1-9(2)14(19-8-13(16)17)12-7-10(3)6-11(4)15(12)18-5/h6-7,9,14H,8H2,1-5H3,(H,16,17)
InChIKeyTXOANXFPVGXMIQ-UHFFFAOYSA-N
XLogP3.11
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 53.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid?
The IUPAC name of 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid (CID 112514986) is 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid.
What is the SMILES notation for 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid?
The canonical SMILES for 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid is COc1c(C)cc(C)cc1C(OCC(=O)O)C(C)C.
What is the InChIKey of 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid?
The InChIKey is TXOANXFPVGXMIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-9(2)14(19-8-13(16)17)12-7-10(3)6-11(4)15(12)18-5/h6-7,9,14H,8H2,1-5H3,(H,16,17).
What are the key properties of 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid?
2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid has a molecular weight of 266.34 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-methoxy-3,5-dimethylphenyl)-2-methylpropoxy]acetic acid is sourced from PubChem (CID 112514986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).