C15H21N3O — CID 112516763
3-cyano-N,4-dimethyl-N-(2-pyridin-4-ylethyl)pentanamide (PubChem CID 112516763) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-cyano-N,4-dimethyl-N-(2-pyridin-4-ylethyl)pentanamide.
| Compound Name | 3-cyano-N,4-dimethyl-N-(2-pyridin-4-ylethyl)pentanamide |
|---|---|
| PubChem CID | 112516763 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-cyano-N,4-dimethyl-N-(2-pyridin-4-ylethyl)pentanamide |
| SMILES | CC(C)C(C#N)CC(=O)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C15H21N3O/c1-12(2)14(11-16)10-15(19)18(3)9-6-13-4-7-17-8-5-13/h4-5,7-8,12,14H,6,9-10H2,1-3H3 |
| InChIKey | BGAABEDEXMMBFB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |