C15H24N6O3 — CID 112520335
N-[1-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]triazol-4-yl]cyclobutanecarboxamide (PubChem CID 112520335) has the molecular formula C15H24N6O3 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[1-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]triazol-4-yl]cyclobutanecarboxamide.
| Compound Name | N-[1-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]triazol-4-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112520335 |
| Molecular Formula | C15H24N6O3 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | N-[1-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]triazol-4-yl]cyclobutanecarboxamide |
| SMILES | O=C(Cn1cc(NC(=O)C2CCC2)nn1)NCCN1CCOCC1 |
| InChI | InChI=1S/C15H24N6O3/c22-14(16-4-5-20-6-8-24-9-7-20)11-21-10-13(18-19-21)17-15(23)12-2-1-3-12/h10,12H,1-9,11H2,(H,16,22)(H,17,23) |
| InChIKey | NMTVVLIMJAOJLN-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |