C17H21N5O2 — CID 112519965
N-[1-[2-oxo-2-(2-phenylethylamino)ethyl]triazol-4-yl]cyclobutanecarboxamide (PubChem CID 112519965) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[1-[2-oxo-2-(2-phenylethylamino)ethyl]triazol-4-yl]cyclobutanecarboxamide.
| Compound Name | N-[1-[2-oxo-2-(2-phenylethylamino)ethyl]triazol-4-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112519965 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[1-[2-oxo-2-(2-phenylethylamino)ethyl]triazol-4-yl]cyclobutanecarboxamide |
| SMILES | O=C(Cn1cc(NC(=O)C2CCC2)nn1)NCCc1ccccc1 |
| InChI | InChI=1S/C17H21N5O2/c23-16(18-10-9-13-5-2-1-3-6-13)12-22-11-15(20-21-22)19-17(24)14-7-4-8-14/h1-3,5-6,11,14H,4,7-10,12H2,(H,18,23)(H,19,24) |
| InChIKey | UXWRLSBAWQYKRK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |