C16H16F3N5O2 — CID 112520718
N-[1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]triazol-4-yl]cyclobutanecarboxamide (PubChem CID 112520718) has the molecular formula C16H16F3N5O2 and a molecular weight of 367.33 g/mol. Its IUPAC name is N-[1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]triazol-4-yl]cyclobutanecarboxamide.
| Compound Name | N-[1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]triazol-4-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112520718 |
| Molecular Formula | C16H16F3N5O2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]triazol-4-yl]cyclobutanecarboxamide |
| SMILES | O=C(Cn1cc(NC(=O)C2CCC2)nn1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3N5O2/c17-16(18,19)11-6-1-2-7-12(11)20-14(25)9-24-8-13(22-23-24)21-15(26)10-4-3-5-10/h1-2,6-8,10H,3-5,9H2,(H,20,25)(H,21,26) |
| InChIKey | TZKNZVJAMCYCNG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |