C20H28N6O2 — CID 112521428
N-[1-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]triazol-4-yl]cyclobutanecarboxamide (PubChem CID 112521428) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[1-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]triazol-4-yl]cyclobutanecarboxamide.
| Compound Name | N-[1-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]triazol-4-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112521428 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | N-[1-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]triazol-4-yl]cyclobutanecarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cn2cc(NC(=O)C3CCC3)nn2)c(C)c1 |
| InChI | InChI=1S/C20H28N6O2/c1-4-25(5-2)16-9-10-17(14(3)11-16)21-19(27)13-26-12-18(23-24-26)22-20(28)15-7-6-8-15/h9-12,15H,4-8,13H2,1-3H3,(H,21,27)(H,22,28) |
| InChIKey | KBVVGDPRYIGYFV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|