C16H24N6O3S — CID 112521419
N-[4-(diethylamino)-2-methylphenyl]-2-[4-(methanesulfonamido)triazol-2-yl]acetamide (PubChem CID 112521419) has the molecular formula C16H24N6O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-[4-(methanesulfonamido)triazol-2-yl]acetamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-[4-(methanesulfonamido)triazol-2-yl]acetamide |
|---|---|
| PubChem CID | 112521419 |
| Molecular Formula | C16H24N6O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-[4-(methanesulfonamido)triazol-2-yl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cn2ncc(NS(C)(=O)=O)n2)c(C)c1 |
| InChI | InChI=1S/C16H24N6O3S/c1-5-21(6-2)13-7-8-14(12(3)9-13)18-16(23)11-22-17-10-15(19-22)20-26(4,24)25/h7-10H,5-6,11H2,1-4H3,(H,18,23)(H,19,20) |
| InChIKey | QRYHIFWWWBEYNH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|