C22H35N3O3 — CID 84554748
tert-butyl 3-[[4-(diethylamino)-2-methylphenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 84554748) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is tert-butyl 3-[[4-(diethylamino)-2-methylphenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(diethylamino)-2-methylphenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 84554748 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | tert-butyl 3-[[4-(diethylamino)-2-methylphenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)c(C)c1 |
| InChI | InChI=1S/C22H35N3O3/c1-7-24(8-2)18-11-12-19(16(3)14-18)23-20(26)17-10-9-13-25(15-17)21(27)28-22(4,5)6/h11-12,14,17H,7-10,13,15H2,1-6H3,(H,23,26) |
| InChIKey | BBMPLUZWGWDATP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|