C17H16N4O3 — CID 112522972
6-amino-3-(7-methyl-6,8-dihydro-5H-2,7-naphthyridine-4-carbonyl)-1,3-benzoxazol-2-one (PubChem CID 112522972) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-amino-3-(7-methyl-6,8-dihydro-5H-2,7-naphthyridine-4-carbonyl)-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-3-(7-methyl-6,8-dihydro-5H-2,7-naphthyridine-4-carbonyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 112522972 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 6-amino-3-(7-methyl-6,8-dihydro-5H-2,7-naphthyridine-4-carbonyl)-1,3-benzoxazol-2-one |
| SMILES | CN1CCc2c(cncc2C(=O)n2c(=O)oc3cc(N)ccc32)C1 |
| InChI | InChI=1S/C17H16N4O3/c1-20-5-4-12-10(9-20)7-19-8-13(12)16(22)21-14-3-2-11(18)6-15(14)24-17(21)23/h2-3,6-8H,4-5,9,18H2,1H3 |
| InChIKey | NITDRVARNNTFJY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|