C18H19N5O — CID 112523720
(6-amino-2-methylbenzimidazol-1-yl)-(7-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl)methanone (PubChem CID 112523720) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is (6-amino-2-methylbenzimidazol-1-yl)-(7-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl)methanone.
| Compound Name | (6-amino-2-methylbenzimidazol-1-yl)-(7-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl)methanone |
|---|---|
| PubChem CID | 112523720 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (6-amino-2-methylbenzimidazol-1-yl)-(7-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl)methanone |
| SMILES | Cc1nc2ccc(N)cc2n1C(=O)c1cncc2c1CCN(C)C2 |
| InChI | InChI=1S/C18H19N5O/c1-11-21-16-4-3-13(19)7-17(16)23(11)18(24)15-9-20-8-12-10-22(2)6-5-14(12)15/h3-4,7-9H,5-6,10,19H2,1-2H3 |
| InChIKey | PCPWBAFMXAQCDG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|