C13H13N5O — CID 112523699
(6-amino-2-methylbenzimidazol-1-yl)-(5-methyl-1H-pyrazol-3-yl)methanone (PubChem CID 112523699) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is (6-amino-2-methylbenzimidazol-1-yl)-(5-methyl-1H-pyrazol-3-yl)methanone.
| Compound Name | (6-amino-2-methylbenzimidazol-1-yl)-(5-methyl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 112523699 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (6-amino-2-methylbenzimidazol-1-yl)-(5-methyl-1H-pyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)n2c(C)nc3ccc(N)cc32)n[nH]1 |
| InChI | InChI=1S/C13H13N5O/c1-7-5-11(17-16-7)13(19)18-8(2)15-10-4-3-9(14)6-12(10)18/h3-6H,14H2,1-2H3,(H,16,17) |
| InChIKey | PCCCEZQVVQZQCS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|