C18H20N6O2 — CID 112523740
3-[[4-(6-amino-2-methylbenzimidazole-1-carbonyl)-2-pyridinyl]methyl]-1,1-dimethylurea (PubChem CID 112523740) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 3-[[4-(6-amino-2-methylbenzimidazole-1-carbonyl)-2-pyridinyl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[4-(6-amino-2-methylbenzimidazole-1-carbonyl)-2-pyridinyl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 112523740 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[[4-(6-amino-2-methylbenzimidazole-1-carbonyl)-2-pyridinyl]methyl]-1,1-dimethylurea |
| SMILES | Cc1nc2ccc(N)cc2n1C(=O)c1ccnc(CNC(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H20N6O2/c1-11-22-15-5-4-13(19)9-16(15)24(11)17(25)12-6-7-20-14(8-12)10-21-18(26)23(2)3/h4-9H,10,19H2,1-3H3,(H,21,26) |
| InChIKey | KKVCSPSIBDAQSR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|