C17H17N5O4 — CID 112522804
3-[[4-(7-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]-1,1-dimethylurea (PubChem CID 112522804) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-[[4-(7-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[4-(7-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 112522804 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-[[4-(7-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCc1cc(C(=O)n2c(=O)oc3c(N)cccc32)ccn1 |
| InChI | InChI=1S/C17H17N5O4/c1-21(2)16(24)20-9-11-8-10(6-7-19-11)15(23)22-13-5-3-4-12(18)14(13)26-17(22)25/h3-8H,9,18H2,1-2H3,(H,20,24) |
| InChIKey | NXYIWTWNIOOMBE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|