About ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate
ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate (PubChem CID 112525915) has the molecular formula C17H16N4O5
and a molecular weight of 356.34 g/mol. Its IUPAC name is ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate |
| PubChem CID | 112525915 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate |
| SMILES | CCOC(=O)NCc1cc(C(=O)n2c(=O)oc3ccc(N)cc32)ccn1 |
| InChI | InChI=1S/C17H16N4O5/c1-2-25-16(23)20-9-12-7-10(5-6-19-12)15(22)21-13-8-11(18)3-4-14(13)26-17(21)24/h3-8H,2,9,18H2,1H3,(H,20,23) |
| InChIKey | CMZYTKUWYHHTJL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate?
The IUPAC name of ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate (CID 112525915) is ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate.
What is the SMILES notation for ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate?
The canonical SMILES for ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate is CCOC(=O)NCc1cc(C(=O)n2c(=O)oc3ccc(N)cc32)ccn1.
What is the InChIKey of ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate?
The InChIKey is CMZYTKUWYHHTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O5/c1-2-25-16(23)20-9-12-7-10(5-6-19-12)15(22)21-13-8-11(18)3-4-14(13)26-17(21)24/h3-8H,2,9,18H2,1H3,(H,20,23).
What are the key properties of ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate?
ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate has a molecular weight of 356.34 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[4-(5-amino-2-oxo-1,3-benzoxazole-3-carbonyl)-2-pyridinyl]methyl]carbamate is sourced from PubChem (CID 112525915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).