C14H17N5O3 — CID 112525138
ethyl N-[[4-(4-amino-3-methylpyrazole-1-carbonyl)-2-pyridinyl]methyl]carbamate (PubChem CID 112525138) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is ethyl N-[[4-(4-amino-3-methylpyrazole-1-carbonyl)-2-pyridinyl]methyl]carbamate.
| Compound Name | ethyl N-[[4-(4-amino-3-methylpyrazole-1-carbonyl)-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 112525138 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | ethyl N-[[4-(4-amino-3-methylpyrazole-1-carbonyl)-2-pyridinyl]methyl]carbamate |
| SMILES | CCOC(=O)NCc1cc(C(=O)n2cc(N)c(C)n2)ccn1 |
| InChI | InChI=1S/C14H17N5O3/c1-3-22-14(21)17-7-11-6-10(4-5-16-11)13(20)19-8-12(15)9(2)18-19/h4-6,8H,3,7,15H2,1-2H3,(H,17,21) |
| InChIKey | MLAKQDCMHLDEMH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |