C12H18N2O2 — CID 155071735
butyl N-[(4-methyl-2-pyridinyl)methyl]carbamate (PubChem CID 155071735) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is butyl N-[(4-methyl-2-pyridinyl)methyl]carbamate.
| Compound Name | butyl N-[(4-methyl-2-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 155071735 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | butyl N-[(4-methyl-2-pyridinyl)methyl]carbamate |
| SMILES | CCCCOC(=O)NCc1cc(C)ccn1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-4-7-16-12(15)14-9-11-8-10(2)5-6-13-11/h5-6,8H,3-4,7,9H2,1-2H3,(H,14,15) |
| InChIKey | GQXMJJNOSYPLPG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|