C19H16F3N3O3 — CID 112523286
3-benzyl-N-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1H-imidazole-4-carboxamide (PubChem CID 112523286) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 3-benzyl-N-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1H-imidazole-4-carboxamide.
| Compound Name | 3-benzyl-N-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 112523286 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-benzyl-N-[2-methoxy-5-(trifluoromethyl)phenyl]-2-oxo-1H-imidazole-4-carboxamide |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)c1c[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H16F3N3O3/c1-28-16-8-7-13(19(20,21)22)9-14(16)24-17(26)15-10-23-18(27)25(15)11-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | IQGWNBNCYCHCGR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |