C12H21N — CID 11252331
1-hexyl-3,4-dimethylpyrrole (PubChem CID 11252331) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-hexyl-3,4-dimethylpyrrole.
| Compound Name | 1-hexyl-3,4-dimethylpyrrole |
|---|---|
| PubChem CID | 11252331 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-hexyl-3,4-dimethylpyrrole |
| SMILES | CCCCCCn1cc(C)c(C)c1 |
| InChI | InChI=1S/C12H21N/c1-4-5-6-7-8-13-9-11(2)12(3)10-13/h9-10H,4-8H2,1-3H3 |
| InChIKey | RFGNRAJWYWPXIR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|