About 1-decylpyridin-4-imine
1-decylpyridin-4-imine (PubChem CID 534503) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-decylpyridin-4-imine.
Molecular Properties
| Compound Name | 1-decylpyridin-4-imine |
| PubChem CID | 534503 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-decylpyridin-4-imine |
| SMILES | [H]N=c1ccn(CCCCCCCCCC)cc1 |
| InChI | InChI=1S/C15H26N2/c1-2-3-4-5-6-7-8-9-12-17-13-10-15(16)11-14-17/h10-11,13-14,16H,2-9,12H2,1H3 |
| InChIKey | OKCJSJRJQAGPQL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decylpyridin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decylpyridin-4-imine?
The IUPAC name of 1-decylpyridin-4-imine (CID 534503) is 1-decylpyridin-4-imine.
What is the SMILES notation for 1-decylpyridin-4-imine?
The canonical SMILES for 1-decylpyridin-4-imine is [H]N=c1ccn(CCCCCCCCCC)cc1.
What is the InChIKey of 1-decylpyridin-4-imine?
The InChIKey is OKCJSJRJQAGPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2/c1-2-3-4-5-6-7-8-9-12-17-13-10-15(16)11-14-17/h10-11,13-14,16H,2-9,12H2,1H3.
What are the key properties of 1-decylpyridin-4-imine?
1-decylpyridin-4-imine has a molecular weight of 234.39 g/mol, XLogP of 4.11, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decylpyridin-4-imine is sourced from PubChem (CID 534503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).