C20H19N3O3S — CID 1125236
(E)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 1125236) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is (E)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 1125236 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (E)-1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCN(C2=NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C20H19N3O3S/c24-19(11-10-16-6-2-1-3-7-16)22-12-14-23(15-13-22)20-17-8-4-5-9-18(17)27(25,26)21-20/h1-11H,12-15H2/b11-10+ |
| InChIKey | ROTYOUYUTQXVCV-ZHACJKMWSA-N |
| XLogP | 1.99 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|