C23H19N3O3 — CID 112523899
3-benzyl-2-oxo-N-(4-phenoxyphenyl)-1H-imidazole-4-carboxamide (PubChem CID 112523899) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-benzyl-2-oxo-N-(4-phenoxyphenyl)-1H-imidazole-4-carboxamide.
| Compound Name | 3-benzyl-2-oxo-N-(4-phenoxyphenyl)-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 112523899 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-benzyl-2-oxo-N-(4-phenoxyphenyl)-1H-imidazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1c[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H19N3O3/c27-22(21-15-24-23(28)26(21)16-17-7-3-1-4-8-17)25-18-11-13-20(14-12-18)29-19-9-5-2-6-10-19/h1-15H,16H2,(H,24,28)(H,25,27) |
| InChIKey | KLUCEAKAKDRLKK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |