C15H8BrCl2NO2 — CID 112525306
6-bromo-N-(2,6-dichlorophenyl)-1-benzofuran-2-carboxamide (PubChem CID 112525306) has the molecular formula C15H8BrCl2NO2 and a molecular weight of 385.04 g/mol. Its IUPAC name is 6-bromo-N-(2,6-dichlorophenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 6-bromo-N-(2,6-dichlorophenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 112525306 |
| Molecular Formula | C15H8BrCl2NO2 |
| Molecular Weight | 385.04 g/mol |
| Exact Mass | 382.91 |
| IUPAC Name | 6-bromo-N-(2,6-dichlorophenyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)c1cc2ccc(Br)cc2o1 |
| InChI | InChI=1S/C15H8BrCl2NO2/c16-9-5-4-8-6-13(21-12(8)7-9)15(20)19-14-10(17)2-1-3-11(14)18/h1-7H,(H,19,20) |
| InChIKey | XAHFUBIEKLAPCP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.04 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |