C16H20N2O3 — CID 112525589
4-methoxy-N-(2-methyl-1,3-benzoxazol-5-yl)cyclohexane-1-carboxamide (PubChem CID 112525589) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-methoxy-N-(2-methyl-1,3-benzoxazol-5-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-methoxy-N-(2-methyl-1,3-benzoxazol-5-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 112525589 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-methoxy-N-(2-methyl-1,3-benzoxazol-5-yl)cyclohexane-1-carboxamide |
| SMILES | COC1CCC(C(=O)Nc2ccc3oc(C)nc3c2)CC1 |
| InChI | InChI=1S/C16H20N2O3/c1-10-17-14-9-12(5-8-15(14)21-10)18-16(19)11-3-6-13(20-2)7-4-11/h5,8-9,11,13H,3-4,6-7H2,1-2H3,(H,18,19) |
| InChIKey | INSSLFDKLKLZMQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |