C17H18N4O3S — CID 112526205
2-(methanesulfonamidomethyl)-N-(2-methyl-1H-indol-5-yl)pyridine-4-carboxamide (PubChem CID 112526205) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-(methanesulfonamidomethyl)-N-(2-methyl-1H-indol-5-yl)pyridine-4-carboxamide.
| Compound Name | 2-(methanesulfonamidomethyl)-N-(2-methyl-1H-indol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 112526205 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(methanesulfonamidomethyl)-N-(2-methyl-1H-indol-5-yl)pyridine-4-carboxamide |
| SMILES | Cc1cc2cc(NC(=O)c3ccnc(CNS(C)(=O)=O)c3)ccc2[nH]1 |
| InChI | InChI=1S/C17H18N4O3S/c1-11-7-13-9-14(3-4-16(13)20-11)21-17(22)12-5-6-18-15(8-12)10-19-25(2,23)24/h3-9,19-20H,10H2,1-2H3,(H,21,22) |
| InChIKey | LZIUEWOWRHQUTK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |