C16H18FN3O3S — CID 112529108
N-[2-(4-fluorophenyl)ethyl]-2-(methanesulfonamidomethyl)pyridine-4-carboxamide (PubChem CID 112529108) has the molecular formula C16H18FN3O3S and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-(methanesulfonamidomethyl)pyridine-4-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-(methanesulfonamidomethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 112529108 |
| Molecular Formula | C16H18FN3O3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-(methanesulfonamidomethyl)pyridine-4-carboxamide |
| SMILES | CS(=O)(=O)NCc1cc(C(=O)NCCc2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C16H18FN3O3S/c1-24(22,23)20-11-15-10-13(7-9-18-15)16(21)19-8-6-12-2-4-14(17)5-3-12/h2-5,7,9-10,20H,6,8,11H2,1H3,(H,19,21) |
| InChIKey | XMEQJPBOQFMKGD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |