C7H4ClF3N2O3S — CID 112527699
5-chloro-4-nitro-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (PubChem CID 112527699) has the molecular formula C7H4ClF3N2O3S and a molecular weight of 288.63 g/mol. Its IUPAC name is 5-chloro-4-nitro-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-4-nitro-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112527699 |
| Molecular Formula | C7H4ClF3N2O3S |
| Molecular Weight | 288.63 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 5-chloro-4-nitro-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C7H4ClF3N2O3S/c8-5-3(13(15)16)1-4(17-5)6(14)12-2-7(9,10)11/h1H,2H2,(H,12,14) |
| InChIKey | KUCPXKZOGVPTDB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.63 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|