C9H9ClO4 — CID 11252919
methyl (1R,4S,6R)-4-chloro-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-6-carboxylate (PubChem CID 11252919) has the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. Its IUPAC name is methyl (1R,4S,6R)-4-chloro-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-6-carboxylate.
| Compound Name | methyl (1R,4S,6R)-4-chloro-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-6-carboxylate |
|---|---|
| PubChem CID | 11252919 |
| Molecular Formula | C9H9ClO4 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | methyl (1R,4S,6R)-4-chloro-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-6-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(Cl)C=C[C@H]1OC2=O |
| InChI | InChI=1S/C9H9ClO4/c1-13-7(11)5-4-9(10)3-2-6(5)14-8(9)12/h2-3,5-6H,4H2,1H3/t5-,6-,9-/m1/s1 |
| InChIKey | XOAKYISYZMWKMK-HCVRKRLWSA-N |
| XLogP | 0.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|