C12H15ClN2 — CID 11253056
7-chloro-2,2,4-trimethyl-1,3-dihydro-1,5-benzodiazepine (PubChem CID 11253056) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 7-chloro-2,2,4-trimethyl-1,3-dihydro-1,5-benzodiazepine.
| Compound Name | 7-chloro-2,2,4-trimethyl-1,3-dihydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 11253056 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 7-chloro-2,2,4-trimethyl-1,3-dihydro-1,5-benzodiazepine |
| SMILES | CC1=Nc2cc(Cl)ccc2NC(C)(C)C1 |
| InChI | InChI=1S/C12H15ClN2/c1-8-7-12(2,3)15-10-5-4-9(13)6-11(10)14-8/h4-6,15H,7H2,1-3H3 |
| InChIKey | OYKXLIXZNQDKHD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |