C7H11N5O2 — CID 112531390
2-(4-aminotriazol-2-yl)-1-(3-hydroxyazetidin-1-yl)ethanone (PubChem CID 112531390) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-(4-aminotriazol-2-yl)-1-(3-hydroxyazetidin-1-yl)ethanone.
| Compound Name | 2-(4-aminotriazol-2-yl)-1-(3-hydroxyazetidin-1-yl)ethanone |
|---|---|
| PubChem CID | 112531390 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-(4-aminotriazol-2-yl)-1-(3-hydroxyazetidin-1-yl)ethanone |
| SMILES | Nc1cnn(CC(=O)N2CC(O)C2)n1 |
| InChI | InChI=1S/C7H11N5O2/c8-6-1-9-12(10-6)4-7(14)11-2-5(13)3-11/h1,5,13H,2-4H2,(H2,8,10) |
| InChIKey | MZLXBISVWRRBTI-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |