C14H15N3O3 — CID 112531668
methyl 1-(2-cyanopyridine-4-carbonyl)piperidine-4-carboxylate (PubChem CID 112531668) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 1-(2-cyanopyridine-4-carbonyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(2-cyanopyridine-4-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 112531668 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | methyl 1-(2-cyanopyridine-4-carbonyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2ccnc(C#N)c2)CC1 |
| InChI | InChI=1S/C14H15N3O3/c1-20-14(19)10-3-6-17(7-4-10)13(18)11-2-5-16-12(8-11)9-15/h2,5,8,10H,3-4,6-7H2,1H3 |
| InChIKey | GPJPZJDPFSHGID-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |