C12H14N4O — CID 83894257
4-(1,4-diazepane-1-carbonyl)pyridine-2-carbonitrile (PubChem CID 83894257) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-(1,4-diazepane-1-carbonyl)pyridine-2-carbonitrile.
| Compound Name | 4-(1,4-diazepane-1-carbonyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 83894257 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-(1,4-diazepane-1-carbonyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(C(=O)N2CCCNCC2)ccn1 |
| InChI | InChI=1S/C12H14N4O/c13-9-11-8-10(2-4-15-11)12(17)16-6-1-3-14-5-7-16/h2,4,8,14H,1,3,5-7H2 |
| InChIKey | KNEYBBPACFSRPR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |