methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate

C16H21NO3 — CID 112533171

IUPACmethyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate
SMILESCCC(CC(=O)OC)NC(=O)c1ccc2c(c1)CCC2
InChIInChI=1S/C16H21NO3/c1-3-14(10-15(18)20-2)17-16(19)13-8-7-11-5-4-6-12(11)9-13/h7-9,14H,3-6,10H2,1-2H3,(H,17,19)
InChIKeyCYOVRJDPFLRSNE-UHFFFAOYSA-N
MW275.35 g/mol
LogP2.25
Rot. Bonds5

About methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate

methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate (PubChem CID 112533171) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate.

Molecular Properties

Compound Namemethyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate
PubChem CID112533171
Molecular FormulaC16H21NO3
Molecular Weight275.35 g/mol
Exact Mass275.15
IUPAC Namemethyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate
SMILESCCC(CC(=O)OC)NC(=O)c1ccc2c(c1)CCC2
InChIInChI=1S/C16H21NO3/c1-3-14(10-15(18)20-2)17-16(19)13-8-7-11-5-4-6-12(11)9-13/h7-9,14H,3-6,10H2,1-2H3,(H,17,19)
InChIKeyCYOVRJDPFLRSNE-UHFFFAOYSA-N
XLogP2.25
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.35
LogP ≤ 52.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate?
The IUPAC name of methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate (CID 112533171) is methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate.
What is the SMILES notation for methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate?
The canonical SMILES for methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate is CCC(CC(=O)OC)NC(=O)c1ccc2c(c1)CCC2.
What is the InChIKey of methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate?
The InChIKey is CYOVRJDPFLRSNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3/c1-3-14(10-15(18)20-2)17-16(19)13-8-7-11-5-4-6-12(11)9-13/h7-9,14H,3-6,10H2,1-2H3,(H,17,19).
What are the key properties of methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate?
methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate has a molecular weight of 275.35 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dihydro-1H-indene-5-carbonylamino)pentanoate is sourced from PubChem (CID 112533171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).