C18H15F3N2O — CID 112534141
2-(2-methylphenyl)-N-[2-(trifluoromethyl)-1H-indol-5-yl]acetamide (PubChem CID 112534141) has the molecular formula C18H15F3N2O and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-(2-methylphenyl)-N-[2-(trifluoromethyl)-1H-indol-5-yl]acetamide.
| Compound Name | 2-(2-methylphenyl)-N-[2-(trifluoromethyl)-1H-indol-5-yl]acetamide |
|---|---|
| PubChem CID | 112534141 |
| Molecular Formula | C18H15F3N2O |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-(2-methylphenyl)-N-[2-(trifluoromethyl)-1H-indol-5-yl]acetamide |
| SMILES | Cc1ccccc1CC(=O)Nc1ccc2[nH]c(C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C18H15F3N2O/c1-11-4-2-3-5-12(11)10-17(24)22-14-6-7-15-13(8-14)9-16(23-15)18(19,20)21/h2-9,23H,10H2,1H3,(H,22,24) |
| InChIKey | TWYJDSIRCZFRGG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |