C24H29NO — CID 112539017
2-(5-tert-butyl-2-methoxyphenyl)-3-naphthalen-1-ylpropan-1-amine (PubChem CID 112539017) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-methoxyphenyl)-3-naphthalen-1-ylpropan-1-amine.
| Compound Name | 2-(5-tert-butyl-2-methoxyphenyl)-3-naphthalen-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 112539017 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-(5-tert-butyl-2-methoxyphenyl)-3-naphthalen-1-ylpropan-1-amine |
| SMILES | COc1ccc(C(C)(C)C)cc1C(CN)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C24H29NO/c1-24(2,3)20-12-13-23(26-4)22(15-20)19(16-25)14-18-10-7-9-17-8-5-6-11-21(17)18/h5-13,15,19H,14,16,25H2,1-4H3 |
| InChIKey | LLMWNXAQNOBKOD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |