C22H31NO — CID 83975069
2-(5-tert-butyl-2-methylphenyl)-3-(2-ethoxyphenyl)propan-1-amine (PubChem CID 83975069) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-methylphenyl)-3-(2-ethoxyphenyl)propan-1-amine.
| Compound Name | 2-(5-tert-butyl-2-methylphenyl)-3-(2-ethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83975069 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 2-(5-tert-butyl-2-methylphenyl)-3-(2-ethoxyphenyl)propan-1-amine |
| SMILES | CCOc1ccccc1CC(CN)c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C22H31NO/c1-6-24-21-10-8-7-9-17(21)13-18(15-23)20-14-19(22(3,4)5)12-11-16(20)2/h7-12,14,18H,6,13,15,23H2,1-5H3 |
| InChIKey | AKMXOLCEJBWHEE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |